Ethyl-d5-amine is a deuterated amine compound where all five hydrogen atoms on the ethyl group are replaced with deuterium. It is primarily used as a reference standard in analytical chemistry, particularly in mass spectrometry and nuclear magnetic resonance spectroscopy.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 17616-24-9
Ethyl-d5-amine hydrochloride
deuterated amine reference standard
Methyl(2H3)ammonium chloride
Deuterated amine reference standard
Diethyl [2,2'-bipyridine]-4,4'-dicarboxylate
bipyridine ligand for coordination chemistry
4-Bromo-p-terphenyl
Research chemical for organic synthesis
5-Chlorooxindole
Research compound for pharmaceutical intermediates
1,4-Dioxane-d8
deuterated NMR reference standard
Ethylamine hydrochloride
production of resins and rubber latex
Ethanamine
Intermediate for herbicides and organic synthesis
1,1,2,2,2-pentadeuterioethanamine
QUSNBJAOOMFDIB-ZBJDZAJPSA-N
[2H]C([2H])([2H])C([2H])([2H])N