N-BOC-piperidine-4-carboxylic acid is a chemical compound used as a pharmaceutical intermediate in organic synthesis. It features a piperidine ring with a tert-butoxycarbonyl (BOC) protecting group and a carboxylic acid functional group, making it valuable for building more complex molecules in drug development.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 174316-71-3
N-BOC-piperidine-4-carboxylic acid
Pharmaceutical intermediate
4-Acetyl-Piperidine-1-Carboxylic Acid Tert-Butyl Ester
Pharmaceutical intermediate
4-Chloro-piperidine-1-carboxylic acid tert-butyl ester
Pharmaceutical intermediate for drug synthesis
Dichlorodivinylsilane
Pharmaceutical intermediate for synthesis
Methyl N-Cbz-piperidine-3-carboxylate
Pharmaceutical intermediate
(R)-(3-(3-Fluoro-4-morpholinophenyl)-2-oxooxazolidin-5-yl)methyl methanesulfonate
Linezolid intermediate
(R)-1-benzyl-2-methylpiperazine
pharmaceutical intermediate
1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid
JWOHBPPVVDQMKB-UHFFFAOYSA-N
CC(C)(C)OC(=O)N1CCC(CC1)C(=O)O