Dehydroabietic acid is a naturally occurring diterpenoid resin acid found predominantly in coniferous trees and is a major component of rosin. It is used in various industrial applications due to its chemical properties.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 1740-19-8
Benzene, 1-ethoxy-2,3-difluoro-4-(trans-4-propylcyclohexyl)-
liquid crystal intermediate
Benzene, 1-[(trans,trans)-4'-ethyl[1,1'-bicyclohexyl]-4-yl]-2,3-difluoro-4-methyl-
liquid crystal intermediate
Vinylphosphonsäure
superlubricity coating for titanium alloys
Sec-Butyl chloroformate
chemical intermediate for synthesis
Dehydroabietinol
abietane diterpenoid research compound
Dichlorodehydroabietic acid
Reference standard for abietic acid impurity
15-Hydroxyferruginol
research compound
(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid
NFWKVWVWBFBAOV-MISYRCLQSA-N
CC(C)C1=CC2=C(C=C1)[C@]3(CCC[C@@]([C@@H]3CC2)(C)C(=O)O)C