2-(Diphenylphosphino)benzoic acid is a research reagent used in phosphorus chemistry. It features a carboxylic acid group and three aromatic rings, contributing to its utility in coordination chemistry studies.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 17261-28-8
(R)-(6,6'-Dimethoxy-[1,1'-biphenyl]-2,2'-diyl)bis(dicyclohexylphosphine)
chiral ligand for asymmetric catalysis
(2S)-1-(3,4-Dimethoxyphenyl)propan-2-amine
research compound for serotonin receptor studies
2-Amino-3-bromo-5-methylpyridine
research compound
3-Bromo-2-fluoro-5-methylpyridine
chemical synthesis intermediate
2-diphenylphosphanylbenzoic acid
UYRPRYSDOVYCOU-UHFFFAOYSA-N
C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3C(=O)O