This compound is a protected hydroxylated piperidine amino acid derivative used as a pharmaceutical intermediate. Its significance lies in its role as a building block for the synthesis of complex drug molecules, featuring both carboxylic acid and alcohol functional groups with defined stereochemistry.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 1704372-95-1
Tert-butyl 2-(hydroxymethyl)pyrrolidine-1-carboxylate
peptide synthesis intermediate
4-Desmethyl-2-methyl Celecoxib
Pharmaceutical impurity reference standard
4-CHLORO-3-METHOXYPYRIDINE-2-CARBOXYLIC ACID
pharmaceutical intermediate
Diphenylphosphinic acid
Pharmaceutical intermediate
(2S,3R)-1-(tert-Butoxycarbonyl)-3-hydroxypiperidine-2-carboxylic acid
Pharmaceutical intermediate
(2S,3S)-3-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylic acid
IVMWRPYVCWVKPQ-YUMQZZPRSA-N
CC(C)(C)OC(=O)N1CCC[C@@H]([C@H]1C(=O)O)O
—