4-Amino-3-nitropyridine is a chemical compound used primarily as a pharmaceutical intermediate. It features a pyridine ring substituted with an amino group and a nitro group, and is employed in the synthesis of other chemical substances for research and manufacturing.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 1681-37-4
(S)-2-AMINO-1-(3-CHLORO-PHENYL)-ETHANOL
Pharmaceutical intermediate
(S)-DMT-glycidol-T
pharmaceutical intermediate for oligonucleotide synthesis
(S)-GNA-T-phosphoramidite
Pharmaceutical intermediate for GNA synthesis
1-[(2R)-3-[bis(4-methoxyphenyl)-phenylmethoxy]-2-hydroxypropyl]-5-methylpyrimidine-2,4-dione
pharmaceutical intermediate
3-nitropyridin-4-amine
IUPPEELMBOPLDJ-UHFFFAOYSA-N
C1=CN=CC(=C1N)[N+](=O)[O-]