O-Benzyl-L-tyrosine is a protected derivative of the amino acid L-tyrosine, featuring a benzyl group attached to the phenolic oxygen. It is primarily used as a building block in solid-phase peptide synthesis, where the benzyl group serves as a temporary protecting group.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 16652-64-5
Benzyl O-benzyl-L-tyrosinate--hydrogen chloride (1/1)
Research reagent for peptide synthesis
(S)-Benzyl 2-amino-3-(4-(benzyloxy)phenyl)propanoate
protected amino acid intermediate
Benzyl L-prolinate HCl
Pharmaceutical intermediate for proline derivatives
H-Ile-Obzl Tos
protected amino acid derivative
O-Benzyl-L-valine toluene-p-sulphonate
Pharmaceutical intermediate for peptide synthesis
4,6-dichloropyridine-3-carbonitrile
Pharmaceutical intermediate for drug synthesis
(2S)-2-amino-3-(4-phenylmethoxyphenyl)propanoic acid
KAFHLONDOVSENM-HNNXBMFYSA-N
C1=CC=C(C=C1)COC2=CC=C(C=C2)C[C@@H](C(=O)O)N