This compound is a peptide-based chromogenic substrate used in enzyme assays. It contains a p-nitroaniline moiety that releases a yellow color upon enzymatic cleavage, enabling spectrophotometric detection.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 162303-66-4
Val-Leu-Arg-p-nitroanilide
chromogenic substrate for enzyme assays
4-Nitrophenyl 4,6-ethylidene-a-D-maltoheptaoside
chromogenic substrate for enzyme assays
3H,4H-thieno[3,2-d]pyrimidin-4-one
research compound
1,3-Diethyl 2-(acetylamino)-2-[2-(4-octylphenyl)ethyl]propanedioate
research compound
4,4'-(Cyclopenta-2,4-dien-1-ylidenemethylene)bis(methylbenzene)
Research compound for organometallic chemistry
5-Bromo-2-thiopheneboronic Acid (contains varying amounts of Anhydride)
boronic acid cross-coupling reagent
(2S)-2-[[(2R)-2-amino-3-methylbutanoyl]amino]-N-[(2S)-5-(diaminomethylideneamino)-1-(4-nitroanilino)-1-oxopentan-2-yl]-4-methylpentanamide;hydrochloride
PMJYPWQXVJFMKT-OXJRKUMDSA-N
CC(C)C[C@@H](C(=O)N[C@@H](CCCN=C(N)N)C(=O)NC1=CC=C(C=C1)[N+](=O)[O-])NC(=O)[C@@H](C(C)C)N.Cl