1,2,3,4,5-Pentadeuterio-6-methylbenzene is a deuterated analytical standard that serves as an isotopically labeled reference compound for quantitative analysis. Its structure features a methyl-substituted aromatic ring where five hydrogen atoms are replaced by deuterium, making it valuable for mass spectrometry and nuclear magnetic resonance spectroscopy calibration.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 1603-99-2
2-HEPTANONE-1,1,1,3,3-D5
deuterated analytical standard
Trans-Cinnamic-d7 acid
deuterated analytical standard
Dimethyl succinate-d4
deuterated analytical standard
(2H10)Cyclohexanone
deuterated analytical standard
X-NeuNAc
Chromogenic substrate for neuraminidase assay
1-(1-bromoethyl)-3,5-bis(trifluoromethyl)benzene
Research reagent for organic synthesis
Hepps
buffer reagent
Uridine, 5'-O-[bis(4-methoxyphenyl)phenylmethyl]-2'-O-propyl-, 3'-[2-cyanoethyl bis(1-methylethyl)phosphoramidite] (9CI)
RNA synthesis building block
1,2,3,4,5-pentadeuterio-6-methylbenzene
YXFVVABEGXRONW-VIQYUKPQSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])C)[2H])[2H]