Fmoc-Lys(Ac)-OH is a protected amino acid derivative used as a building block in solid-phase peptide synthesis. The Fmoc group protects the alpha-amino group, while the acetylated lysine side chain allows for selective incorporation of acetyllysine into peptide sequences.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 159766-56-0
(2S)-2,6-bis({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)hexanoic acid
Protected amino acid for peptide synthesis
(2S)-6-{[(benzyloxy)carbonyl]amino}-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}hexanoic acid
peptide synthesis protected amino acid
Z-Lys(Fmoc)-OH
Protected lysine derivative for peptide synthesis
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-6-{[(prop-2-en-1-yloxy)carbonyl]amino}hexanoic acid
Protected amino acid for peptide synthesis
FMOC-PHE(4-BR)-OH
Research compound for peptide synthesis
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(naphthalen-2-yl)propanoic acid
Research compound for peptide synthesis
Fmoc-N-methyl-L-alloisoleucine
Research compound for peptide synthesis
4-Methyl-L-phenylalanine
Research compound for peptide synthesis
(2S)-6-acetamido-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid
HQLBYVWJOXITAM-NRFANRHFSA-N
CC(=O)NCCCC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13