This compound is a pharmaceutical intermediate featuring a piperidine ring with a methylene group and a tert-butoxycarbonyl (Boc) protecting group. It is primarily used in the synthesis of more complex molecules for pharmaceutical manufacturing.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 159635-49-1
1-[(tert-butoxy)carbonyl]azetidine-2-carboxylic acid
Pharmaceutical intermediate for peptide synthesis
Fmoc-Aad(otBu)-OH
Protected amino acid for peptide synthesis
Diamminediiodoplatinum
platinum-based pharmaceutical intermediate
(E)-2-cyano-3-morpholinoacrylamide
Pharmaceutical intermediate
4-methylenepiperidine hydrochloride
pharmaceutical intermediate
tert-butyl 4-methylidenepiperidine-1-carboxylate
PDTZMULNKGUIEJ-UHFFFAOYSA-N
CC(C)(C)OC(=O)N1CCC(=C)CC1