This compound is a salt-form pharmaceutical intermediate used in the production of bromhexine derivatives. It features a complex polycyclic structure containing amine, alcohol, and halogen functional groups.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 15942-08-2
Ambroxol EP Impurity B
Pharmaceutical intermediate for ambroxol
(2s)-1-[(tert-butoxy)carbonyl]piperazine-2-carboxylic acid
Boc-protected piperazine carboxylic acid intermediate
Benzyl (2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate;hydrochloride
Peptide synthesis protected amino acid
(2S)-6-azido-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)hexanoic acid
Fmoc-protected amino acid building block
(1R,2S)-1-(((1,1-Dimethylethoxy)carbonyl)amino)-2-ethenylcyclopropanecarboxylic acid
Pharmaceutical intermediate
Ambroxol Cyclic Impurity-d5 Dihydrochloride
n.a
4-(6,8-dibromo-2,4-dihydro-1H-quinazolin-3-yl)cyclohexan-1-ol;hydrochloride
ICLHRFYBPXBCPE-UHFFFAOYSA-N
C1CC(CCC1N2CC3=C(C(=CC(=C3)Br)Br)NC2)O.Cl