(S)-gamma-fluoroleucine ethyl ester is a chiral, fluorinated amino acid derivative used as a pharmaceutical intermediate in the manufacture of active pharmaceutical ingredients. Its structure features an amine, an ester, and a halogen, contributing to its role in chemical synthesis for drug development.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 156047-39-1
5-Bromo-3-methylpyridine-2-carbonitrile
Pharmaceutical intermediate
6-Bromo-4-methylpyridin-3-amine
Pharmaceutical intermediate for drug synthesis
ADL 08-0011
alvimopan metabolite
Ent-Alvimopan
Alvimopan impurity
ethyl (2S)-2-amino-4-fluoro-4-methylpentanoate
MJEBOMLXSMSDDI-LURJTMIESA-N
CCOC(=O)[C@H](CC(C)(C)F)N