Trimethylacetic anhydride is a chemical compound used as a research reagent for organic synthesis. It functions as a derivatization agent in analytical chemistry and serves as a building block for introducing the trimethylacetyl group into target molecules.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 1538-75-6
L-Glutamine, N2-((1,1-dimethylethoxy)carbonyl)-, 4-nitrophenyl ester
peptide synthesis intermediate
2-cyclopropyl-1,1-difluoro-3-methoxypropan-2-ol
research compound
2,2'-Dipicolylamine
research reagent for coordination chemistry
5-Fluoro-dl-tryptophan
non-proteinogenic amino acid research compound
2,2-dimethylpropanoyl 2,2-dimethylpropanoate
PGZVFRAEAAXREB-UHFFFAOYSA-N
CC(C)(C)C(=O)OC(=O)C(C)(C)C