(4-Isobutylphenyl)boronic acid is a boronic acid derivative featuring an aromatic ring substituted with an isobutyl group. It is commonly used as a research reagent in organic synthesis and medicinal chemistry.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 153624-38-5
Sec-Butylmagnesium chloride
Grignard reagent for organic synthesis
Creatine Ethyl Ester HCL
research compound
Methyl 1H-pyrazole-3-carboxylate
research compound
3-[2-[2-[2-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid
research compound for click chemistry
[4-(2-methylpropyl)phenyl]boronic acid
YZSPHVWALUJQNK-UHFFFAOYSA-N
B(C1=CC=C(C=C1)CC(C)C)(O)O