L-N-Butylsulfonyl-p-hydroxyphenylalanine is a chemical compound with the formula C13H19NO5S. It functions as a pharmaceutical intermediate, primarily used in the synthesis of active pharmaceutical ingredients.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 149490-60-8
Propanedioic acid, 2-(4-bromophenyl)-, 1,3-dimethyl ester
pharmaceutical intermediate
4-(4-CYANOPHENYL)PIPERIDINE
Pharmaceutical intermediate
6-BROMO-5-(TRIFLUOROMETHYL)NICOTINONITRILE
Pharmaceutical intermediate
1-N-Boc-pyrrolidin-2-ylboronic acid
pharmaceutical intermediate synthesis
(2S)-2-(butylsulfonylamino)-3-(4-hydroxyphenyl)propanoic acid
VCKJOKXXEIQENI-LBPRGKRZSA-N
CCCCS(=O)(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O