4-Acetylphenylboronic acid is a boronic acid derivative featuring an acetyl-substituted aromatic ring. It is commonly used as a research reagent in organic synthesis, particularly in cross-coupling reactions.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 149104-90-5
3-Acetylphenylboronic acid
Boronic acid research reagent
B-Hexylboronic acid
Boronic acid research reagent
2-(Trifluoromethoxy)phenylboronic Acid (contains varying amounts of Anhydride)
Boronic acid research reagent
4-Fluorophenylboronic acid
Boronic acid research reagent
(R)-5-Bromo-N-(4-(chlorodifluoromethoxy)phenyl)-6-(3-hydroxypyrrolidin-1-yl)nicotinamide
research compound
6-Nitropyridin-3-amine
Research reagent for hachimoji DNA
Trifluormethansulfonsäure
catalyst and acid titrant
Arachidonyltrifluoromethane
Phospholipase A2 inhibitor
(4-acetylphenyl)boronic acid
OBQRODBYVNIZJU-UHFFFAOYSA-N
B(C1=CC=C(C=C1)C(=O)C)(O)O