1-Benzylpiperidin-3-ol is a chemical compound used as a research reagent. It features a piperidine ring with a benzyl substituent and an alcohol group, commonly supplied for laboratory and synthetic chemistry studies.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 14813-01-5
N-Benzyl-3-pyrrolidinol
pharmaceutical intermediate
(S)-(-)-1-Benzyl-3-pyrrolidinol
pharmaceutical intermediate for drug synthesis
(R)-(+)-1-Benzyl-3-pyrrolidinol
pharmaceutical intermediate
Tert-Butyl 4-formyl-5-methoxy-7-methyl-1H-indole-1-carboxylate
research compound
Factor B-IN-1
complement factor B inhibitor
(S)-(+)-2,3-Diaminopropionic Acid Hydrochloride
Non-protein amino acid research reagent
3-((Aminoiminomethyl)amino)-L-alanine monohydrochloride
Research reagent biochemical reference standard
(3R)-1-benzylpiperidin-3-amine
pharmaceutical intermediate
1-benzylpiperidin-3-ol
UTTCOAGPVHRUFO-UHFFFAOYSA-N
C1CC(CN(C1)CC2=CC=CC=C2)O