Indole-2-carboxylic acid is an indolyl carboxylic acid used primarily as a research compound or assay reagent. Its structure features a carboxylic acid group attached to an indole ring, contributing to its utility in laboratory studies.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 1477-50-5
Propionic-2,2-d2 acid-d
deuterated research reagent
Omega-conotoxin MVIIC
research compound
Copper(ii)hexafluor-2,4-pentanedionate
Coordination chemistry research reagent
Dichloro(1,10-phenanthroline)copper(II)
research compound
1H-indole-2-carboxylic acid
HCUARRIEZVDMPT-UHFFFAOYSA-N
C1=CC=C2C(=C1)C=C(N2)C(=O)O