4-Chloro-D-phenylalanine hydrochloride is a research compound that serves as a salt form of a halogenated phenylalanine derivative. It is primarily used in laboratory settings as a reagent for studying biochemical pathways and amino acid analogs.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 147065-05-2
Alcaftadine Alcohol
pharmaceutical impurity reference standard
(4-chloronaphthalen-1-yl)boronic acid
research compound
N-((S)-1-(((S)-1-(Benzo[d]thiazol-2-yl)-1-oxo-3-((S)-2-oxopyrrolidin-3-yl)propan-2-yl)amino)-4-methyl-1-oxopentan-2-yl)-4-methoxy-1H-indole-2-carboxamide
SARS-CoV 3CL protease inhibitor
2-Amino-3-(thiazol-4-yl)propanoic acid
research compound
(2R)-2-amino-3-(4-chlorophenyl)propanoic acid;hydrochloride
PFOCEDBJFKVRHU-DDWIOCJRSA-N
C1=CC(=CC=C1C[C@H](C(=O)O)N)Cl.Cl