Methyl 3,5-diamino-6-chloropyrazine-2-carboxylate is a chemical compound used as a pharmaceutical intermediate. It serves as a key building block in the synthesis of active pharmaceutical ingredients.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 1458-01-1
Dimethyl 1,3-adamantanedicarboxylate
pharmaceutical intermediate
(1S,2S)-2-(3,4-Difluorophenyl)cyclopropanamine
Pharmaceutical intermediate
1-(2-(Hydroxymethyl)-1,3-oxathiolan-5-yl)pyrimidine-2,4(1H,3H)-dione, (2R,5S)-
Pharmaceutical intermediate for antivirals
(R)-2-amino-2-methylsuccinic acid
amino acid building block
methyl 3,5-diamino-6-chloropyrazine-2-carboxylate
KOOBYHRLTYIPTH-UHFFFAOYSA-N
COC(=O)C1=C(N=C(C(=N1)Cl)N)N