Copper(II) ethylacetoacetate is a copper coordination compound primarily used as a research reagent. It serves as a source of copper ions in synthetic and materials chemistry studies.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 14284-06-1
Rhodium(III) 2,4-pentanedionate
Research reagent and reference standard
Ruthenium(III) acetylacetonate
coordination chemistry research reagent
((5Alpha,6Alpha)-4,5-Epoxymorphinan-3,6-diol)
Certified reference standard
N4-Acetylcytidine triphosphate
Modified nucleotide triphosphate for research
copper bis(ethyl 3-oxobutanoate)
OXFZSJOUPRCPJO-UHFFFAOYSA-N
CCOC(=O)[CH-]C(=O)C.CCOC(=O)[CH-]C(=O)C.[Cu+2]