This compound is a pharmaceutical intermediate featuring a complex polycyclic core with a sulfonyl-substituted aromatic ring. Its structure includes an ethylpyrrolidine moiety and multiple nitrogen-containing rings, reflecting its role in the synthesis of advanced pharmaceutical agents.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 1428243-28-0
4-Desmethoxy-4-nitro Omeprazole Sulfide
Pharmaceutical intermediate for omeprazole analogs
N1-methylpseudouridine-5'-triphosphate
pharmaceutical intermediate
Fezolinetant Impurity 3
Pharmaceutical intermediate
(R)-1-(2,4-dimethoxybenzyl)-5-ethoxy-6-methyl-1,2,3,6-tetrahydropyrazine
pharmaceutical intermediate impurity reference standard
(3S,4R)-3-ethyl-4-(3-tosyl-3H-imidazo[1,2-a]pyrrolo[2,3-e]pyrazin-8-yl)-N-(2,2,2-trifluoroethyl)pyrrolidine-1-carboxamide
pharmaceutical intermediate
12-[(3R,4S)-4-ethylpyrrolidin-3-yl]-5-(4-methylphenyl)sulfonyl-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene
VJDVHRAORKIHCS-WBVHZDCISA-N
CC[C@@H]1CNC[C@@H]1C2=CN=C3N2C4=C(N=C3)N(C=C4)S(=O)(=O)C5=CC=C(C=C5)C