This compound is a research reagent, specifically a protected amino acid derivative featuring a benzoic acid core with an N-methyl and tert-butoxycarbonyl (Boc) protecting group. Its significance lies in its use as a building block for peptide synthesis and other organic chemistry applications.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 141871-02-5
Methyl 1,4-dihydroxy-7-phenoxyisoquinoline-3-carboxylate
research compound
Methyl 1-chloro-4-hydroxy-7-phenoxyisoquinoline-3-carboxylate
research compound
2-Bromo-6-fluorotoluene
Research reagent for organic synthesis
Bis(benzonitrile)palladium chloride
coordination complex and catalyst precursor
2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]benzoic acid
UXLICAHPTWWCII-UHFFFAOYSA-N
CC(C)(C)OC(=O)N(C)C1=CC=CC=C1C(=O)O