This compound is a benzofuran derivative featuring a nitro group and a hydroxyphenyl ketone moiety. It is primarily used as a pharmaceutical intermediate in the synthesis of other chemical compounds.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 141645-16-1
(2-Butyl-5-nitrobenzofuran-3-yl)(4-methoxyphenyl)methanone
research compound
(5-Bromo-3-(trifluoromethyl)pyridin-2-yl)methanamine hydrochloride
pharmaceutical synthetic intermediate
3-[[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(6-oxo-1H-purin-9-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile
DNA synthesis phosphoramidite building block
Tert-butyl 3-hydroxyazetidine-1-carboxylate
protected building block for synthesis
Tert-Butyl 3-((methylsulfonyl)oxy)pyrrolidine-1-carboxylate
Pharmaceutical intermediate
(2-Butyl-5-nitrobenzofuran-3-yl)(4-(3-dibutylaminopropoxy)phenyl)methanone
active pharmaceutical ingredient
(2-Butylbenzofuran-3-yl) (4-hydroxyphenyl) ketone
pharmaceutical intermediate
1-Methoxy Amiodarone
pharmaceutical impurity reference standard
(2-butyl-5-nitro-1-benzofuran-3-yl)-(4-hydroxyphenyl)methanone
ZJZKLBXEGZKOBW-UHFFFAOYSA-N
CCCCC1=C(C2=C(O1)C=CC(=C2)[N+](=O)[O-])C(=O)C3=CC=C(C=C3)O