This compound is a hydrochloride salt of Fmoc-protected L-lysine, commonly used as a building block in solid-phase peptide synthesis. Its significance lies in the Fmoc (9-fluorenylmethoxycarbonyl) group, which temporarily protects the amino group during peptide chain assembly.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 139262-23-0
Fmoc-L-lysine
Protected amino acid for peptide synthesis
Benzyl (2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate;hydrochloride
Peptide synthesis protected amino acid
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)hexanoic acid
Fmoc-protected amino acid for peptide synthesis
Aceclofenac Methyl Ester
Pharmaceutical intermediate for aceclofenac synthesis
Aceclofenac Ethyl Ester
Pharmaceutical intermediate for aceclofenac production
Aceclofenac Tert-Butyl Ester
Pharmaceutical intermediate for aceclofenac synthesis
Tert-butyl 4-(methoxy(methyl)carbamoyl)piperidine-1-carboxylate
Pharmaceutical intermediate
Fmoc-D-Lys-OH.HCl
Fmoc-protected amino acid intermediate
(2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid;hydrochloride
MVMZFAIUUXYFGY-FYZYNONXSA-N
C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCCCN)C(=O)O.Cl