(3-Phenoxyphenyl)methanol is a chemical compound primarily known as a metabolite formed during the hydrolysis of certain pyrethroid insecticides, such as permethrin, by enzymes like pyrethroid hydrolase. It features an alcohol group, two aromatic rings, and an ether linkage, contributing to its moderate lipophilicity and polar surface area.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 13826-35-2
3-Phenoxybenzoic acid
pyrethroid insecticide metabolite
Imidacloprid
systemic insecticide for crop protection
1-[(difluoromethyl)sulfonyl]-3-(4,6-dimethoxy-1,3,5-triazin-2-yl)-7-fluoro-1H-indol-2-ol
Agrochemical intermediate or active ingredient
2,4-DICHLOROTOLUENE-3,5,6-D3
Deuterated agrochemical reference standard
Quizalofop-ethyl D3 (3,3,3-D3)
Herbicide active ingredient
(3-phenoxyphenyl)methanol
KGANAERDZBAECK-UHFFFAOYSA-N
C1=CC=C(C=C1)OC2=CC=CC(=C2)CO