Dipropyl pyridine-2,5-dicarboxylate is an agrochemical compound used primarily as an insect repellent. Its structure features a pyridine ring with two ester functional groups, contributing to its chemical properties.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 136-45-8
Dimethyl carbate
insect repellent
Urea, N-[2,6-bis(1-methylethyl)-4-phenoxyphenyl]-N'-(1,1-dimethylethyl)-
urea herbicide intermediate
3,5-dichloro-2,4,6-trifluorobenzoic acid
agrochemical intermediate
Thiram
Crop fungicide and seed protectant
ZIRAM
fungicide for vegetable diseases
dipropyl pyridine-2,5-dicarboxylate
IITCWRFYJWUUPC-UHFFFAOYSA-N
CCCOC(=O)C1=CN=C(C=C1)C(=O)OCCC