This compound is a boronic acid derivative featuring a pyrrole ring protected by a tert-butoxycarbonyl (Boc) group. It is primarily used as a pharmaceutical intermediate in the synthesis of complex organic molecules for research and manufacturing.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 135884-31-0
5-chloro-2-hydroxybenzonitrile
pharmaceutical intermediate
3-(tert-Butyl)-6-(ethylthio)-1,3,5-triazine-2,4(1H,3H)-dione
Pharmaceutical intermediate synthesis
Methyl 6-methylpyridine-2-carboxylate
Pharmaceutical intermediate for synthesis
(1R,2S)-(+)-cis-1-Amino-2-indanol
Pharmaceutical intermediate for chiral synthesis
[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrol-2-yl]boronic acid
ZWGMJLNXIVRFRJ-UHFFFAOYSA-N
B(C1=CC=CN1C(=O)OC(C)(C)C)(O)O