This compound is a protected derivative of D-glutamic acid, featuring both benzoyl and methyl ester protecting groups. It is primarily used as a pharmaceutical intermediate in the synthesis of peptides and other complex organic molecules.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 1346773-61-2
H-Ile-Obzl Tos
protected amino acid derivative
2-Hydroxy-5-iodopyridine
Pharmaceutical intermediate
5-Bromo-2-methoxypyridine
pharmaceutical intermediate
N-Nitrosonadolol
Nitrosamine impurity standard
2(1H)-Quinazolinone, 4-amino-6,7-dimethoxy-, monohydrochloride
Pharmaceutical intermediate for quinazolinone synthesis
dimethyl (2R)-2-benzamidopentanedioate
JOTSRQZZNLVBKG-LLVKDONJSA-N
COC(=O)CC[C@H](C(=O)OC)NC(=O)C1=CC=CC=C1