4-Bromochlorobenzene-d4 is a deuterated reference standard compound, specifically the tetradeuterated analogue of 1-bromo-4-chlorobenzene where all four aromatic hydrogen atoms are replaced by deuterium. It is primarily used as an internal standard or labeled tracer in analytical chemistry, particularly for mass spectrometry and nuclear magnetic resonance spectroscopy.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 134415-42-2
(1R)-1-(3-chloro-4-fluorophenyl)ethan-1-ol
research compound
(R)-[2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl dichlororuthenium
asymmetric hydrogenation catalyst
Gold(III)-iodid
research compound
2,4-Diphenyl-6-(4,4,5,5-tetramethyl-[1,3,2] dioxaborolan-2-yl)-[1,3,5]triazine
research reagent
1-Bromo-4-chlorobenzene
Chemical intermediate for synthesis
1-bromo-4-chloro-2,3,5,6-tetradeuteriobenzene
NHDODQWIKUYWMW-RHQRLBAQSA-N
[2H]C1=C(C(=C(C(=C1Cl)[2H])[2H])Br)[2H]