Trityllosartan is a chemical compound used as a pharmaceutical intermediate, specifically in the synthesis of the antihypertensive drug losartan. Its structure features a tetrazole ring with a trityl protecting group, which is characteristic of intermediates used in sartan-class drug manufacturing.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 133909-99-6
(2-BUTYL-4-CHLORO-1-((2'-(1-TRITYL-1H-TETRAAZOL-5-YL)(1,1'-BIPHENYL)-4-YL)METHYL)-1H-IMIDAZOL-5-YL)METHANOL
pharmaceutical impurity standard
Alogliptin Impurity 70
pharmaceutical intermediate for alogliptin
8-Hydroxyquinoline sulfate
chelating agent for metal ions
4-Chlorobenzhydryl chloride
Pharmaceutical intermediate for synthesis
4-Chlorbenzophenon
pharmaceutical intermediate
N-Trityl Olmesartan Ethyl Ester
pharmaceutical intermediate
[2-butyl-5-chloro-3-[[4-[2-(2-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methanol
QQPGGBNMTNDKEY-UHFFFAOYSA-N
CCCCC1=NC(=C(N1CC2=CC=C(C=C2)C3=CC=CC=C3C4=NN(N=N4)C(C5=CC=CC=C5)(C6=CC=CC=C6)C7=CC=CC=C7)CO)Cl