Dov-Val-Dil-OH is a pharmaceutical intermediate used in peptide synthesis. This compound features a complex structure with multiple functional groups including amide and acid moieties, suitable for incorporation into specialized peptide sequences.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 133120-89-5
3,5-difluoro-4-(4-(4-fluorophenyl)piperidin-1-yl)aniline
pharmaceutical intermediate
Apalutamide metabolite M4
pharmaceutical metabolite reference standard
N-[3-Fluoro-4-[(methylamino)carbonyl]phenyl]-2-methylalanine methyl ester
enzalutamide intermediate
3-(2-Chloropropanoyl)spiro[benzo[e][1,3]oxazine-2,1'-cyclohexan]-4(3H)-one
pharmaceutical intermediate
(3R,4S,5S)-4-[[(2S)-2-[[(2S)-2-(dimethylamino)-3-methylbutanoyl]amino]-3-methylbutanoyl]-methylamino]-3-methoxy-5-methylheptanoic acid
RHYYEUIJXQMEBX-DLRXZHIHSA-N
CC[C@H](C)[C@@H]([C@@H](CC(=O)O)OC)N(C)C(=O)[C@H](C(C)C)NC(=O)[C@H](C(C)C)N(C)C