N-epsilon-t-Butyloxycarbonyl-L-lysine t-butyl ester hydrochloride is a protected lysine derivative commonly used as a pharmaceutical intermediate. Its structure features an amino group and two ester moieties, reflecting its role in peptide synthesis and drug manufacturing.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 13288-57-8
H-Lys(Boc)-OMe.HCl
Protected lysine derivative for peptide synthesis
(S)-1-Boc-3-methanesulfonyloxy-pyrrolidine
Pharmaceutical intermediate for pyrrolidine derivatives
(R)-1-Boc-3-cyanopyrrolidine
pharmaceutical intermediate
(S)-1-Boc-3-cyanopyrrolidine
pharmaceutical intermediate
D-Ribofuranose, 1-acetate
nucleoside synthesis intermediate
tert-butyl (2S)-2-amino-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate;hydrochloride
TZBPQINFXPIRBX-MERQFXBCSA-N
CC(C)(C)OC(=O)[C@H](CCCCNC(=O)OC(C)(C)C)N.Cl