2,6-Dichloropurine riboside is a purine nucleoside analog consisting of a ribose sugar moiety and a 2,6-dichloropurine base. It serves as a key building block in the synthesis of various nucleoside analogue pharmaceuticals.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 13276-52-3
2-Chloroadenosine
adenosine receptor agonist
2-Amino-6-chloropurine riboside
pharmaceutical intermediate for nucleotide synthesis
2-Chloro-9-pentofuranosyl-9H-purin-6-amine--water (1/1)
Nucleoside analog research reagent
Ethyl (4-(3-oxomorpholino)phenyl)carbamate
pharmaceutical intermediate
2-((3-Chlorophenyl)amino)benzoic acid
pharmaceutical intermediate
4-Chloro-2,5-difluorobenzoic acid
Pharmaceutical intermediate
2-Chloro-4-(4-fluorophenyl)-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine
pharmaceutical intermediate
(2R,3R,4S,5R)-2-(2,6-dichloropurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol
HJXWZGVMHDPCRS-UUOKFMHZSA-N
C1=NC2=C(N1[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N=C(N=C2Cl)Cl