2-Bromo-3-fluorobenzoic acid is a halogenated benzoic acid derivative used primarily as a research compound. It features both bromine and fluorine substituents on the aromatic ring, contributing to its utility in synthetic chemistry studies.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 132715-69-6
Phosphine, dicyclohexyl(1,1-dimethylethyl)-, tetrafluoroborate
Research reagent for organic synthesis
2-(2-Bromophenyl)-1H-benzimidazole
research compound for crystallography studies
1,4-Bis(2-methylstyryl)benzene
Scintillation research reagent
2,2'-Bithiophene-5-boronic acid
research compound
2-bromo-3-fluorobenzoic acid
KQRCBMPPEPNNDS-UHFFFAOYSA-N
C1=CC(=C(C(=C1)F)Br)C(=O)O