tert-Butyl L-valinate is the tert-butyl ester of the amino acid L-valine. It is commonly used as a research compound in laboratory settings.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 13211-31-9
4,4'-Bipyridyl-d8
deuterated analytical reference standard
4-Methoxyhippuric acid
biochemical research reagent
Dotap chloride
cationic lipid transfection reagent
5-Cyano-2-methylindole-3-acetic acid
indole derivative research compound
H-D-Val-OtBu hydrochloride
Pharmaceutical intermediate for peptide synthesis
tert-butyl (2S)-2-amino-3-methylbutanoate
RJBVJBGFJIHJSZ-ZETCQYMHSA-N
CC(C)[C@@H](C(=O)OC(C)(C)C)N