Z-Gly-Gly-Phe-OH is a protected tetrapeptide derivative consisting of glycine, glycine, and phenylalanine residues with a benzyloxycarbonyl (Z) protecting group. It is commonly employed as a research compound in peptide synthesis and biochemical studies.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 13171-93-2
2-(trifluoromethyl)pyridine-4-carboxylic acid
research compound
2-(Trifluoromethyl)pyridine-3-carboxylic acid
research compound
(2-(trifluoromethyl)pyridin-3-yl)methanol
research compound
(1S)-1-(2-chlorophenyl)ethan-1-ol
research compound
(2S)-3-phenyl-2-[[2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetyl]amino]propanoic acid
PARPWSYTROKYNG-KRWDZBQOSA-N
C1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)CNC(=O)CNC(=O)OCC2=CC=CC=C2