N-(2-Pyridyl)oxamic acid is a research compound featuring a carboxylic acid and an amide group attached to a pyridine ring. It is primarily used as a laboratory reagent for chemical synthesis and investigative studies.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 13120-39-3
Rhodium(2+) (2S)-2-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)-3-phenylpropanoate--ethyl acetate (2/4/1)
research compound for catalysis
Benzene-d, 4-bromo-
deuterated research compound
1-Chloro-4-deuteriobenzene
Deuterated research reference compound
Azido-PEG2-NHS ester
PEGylation reagent for bioconjugation
2-oxo-2-(pyridin-2-ylamino)acetic acid
RQLBRIIHVJSCTG-UHFFFAOYSA-N
C1=CC=NC(=C1)NC(=O)C(=O)O