5-Acetylsalicylic acid is a chemical compound that serves as a pharmaceutical intermediate, specifically used in the production of acetylsalicylic acid (aspirin) and as a reference impurity standard for quality control in pharmaceutical manufacturing. It is a derivative of salicylic acid, a naturally occurring plant hormone originally derived from willow bark.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 13110-96-8
4-Hydroxyisophthalic acid
chemical intermediate for synthesis
(2-Aminothiazol-5-yl)methanol
Pharmaceutical intermediate
8-BROMO-5,6-DIFLUORO-2-METHYLQUINOLINE
pharmaceutical intermediate
Tert-butyl 4-(chloromethyl)-4-(hydroxymethyl)piperidine-1-carboxylate
Pharmaceutical intermediate for piperidine derivatives
TERT-BUTYL 6-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)NAPHTHALEN-2-YLCARBAMATE
Pharmaceutical intermediate for API synthesis
5-acetyl-2-hydroxybenzoic acid
NZRDKNBIPVLNHA-UHFFFAOYSA-N
CC(=O)C1=CC(=C(C=C1)O)C(=O)O