Spiroalmotriptan is a spirocyclic indoline derivative featuring a pyrrolidine sulfonylmethyl substituent. It is characterized by a complex fused-ring structure that includes an alcohol functional group and multiple heterocyclic rings, with a molecular weight of approximately 351 Da, moderate lipophilicity, and two hydrogen bond donors.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 1309457-18-8
Dolutegravir S,R
active pharmaceutical ingredient
Meglumine diatrizoate
diagnostic contrast medium
Dioxybenzone
Cosmetic ultraviolet absorber
Boldenone undecylenate
active pharmaceutical ingredient
1'-methyl-5-(pyrrolidin-1-ylsulfonylmethyl)spiro[1,2-dihydroindole-3,3'-pyrrolidine]-2-ol
LXSWXVHNXSOIPG-UHFFFAOYSA-N
CN1CCC2(C1)C(NC3=C2C=C(C=C3)CS(=O)(=O)N4CCCC4)O