This compound is a pharmaceutical intermediate used in the synthesis of ozanimod, a medication for autoimmune conditions. It features a nitrile group and a stereocenter, indicating its role in building complex molecular structures for drug development.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 1306763-31-4
3-((2-Chloromethyl-1-methyl-1H-benzimidazole-5-carbonyl)-pyridine-2-yl-amino)-propionic acid ethyl ester
Pharmaceutical intermediate for drug synthesis
2-Bromo-6-nitrophenol
pharmaceutical intermediate
Fmoc-D-Arg-OH
Peptide synthesis intermediate
3-oxo-8-aza-bicyclo[3.2.1]octane-8-carboxylic acid benzyl ester
pharmaceutical intermediate for tropane alkaloids
(S)-1-Amino-2,3-dihydro-1H-indene-4-carbonitrile hydrochloride
pharmaceutical intermediate for synthesis
(R)-1-Aminoindane-d3 Hydrochloride
deuterated pharmaceutical research standard
(1R,2S)-(+)-cis-1-Amino-2-indanol
Pharmaceutical intermediate for chiral synthesis
5-bromo-2,3-dihydro-1H-inden-4-amine
research compound
tert-butyl N-[(1S)-4-cyano-2,3-dihydro-1H-inden-1-yl]carbamate
LBHMMDUJKBJVQI-ZDUSSCGKSA-N
CC(C)(C)OC(=O)N[C@H]1CCC2=C(C=CC=C12)C#N