l-Methionine-d3 is a deuterated form of the amino acid L-methionine, commonly used as an isotopically labeled research compound. It is primarily applied in analytical and metabolic studies to trace biochemical pathways or quantify methionine-related processes.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 13010-53-2
Dopamine-d4 hydrochloride
isotopically labeled research compound
Rac Ambrisentan-d3 Methyl Ester
isotopically labeled research compound
Butyryl-L-carnitine-d3 (chloride)
isotopically labeled research compound
Carbon-13C monoxide
isotopically labeled research compound
Propan-2-yl-oxocyclobutane carboxylate
research compound
1-Bromohexane-d13
Deuterated research reagent
Methyl 4,4-difluoropiperidine-2-carboxylate
research compound
(-)-tert-Butyl glycidyl ether
research compound
(2S)-2-amino-4-(trideuteriomethylsulfanyl)butanoic acid
FFEARJCKVFRZRR-OSIBIXDNSA-N
[2H]C([2H])([2H])SCC[C@@H](C(=O)O)N