Clenbuterol D9 is an isotope-labeled research compound, specifically a deuterated form of clenbuterol, featuring nine deuterium atoms. It is commonly used in analytical research as an internal standard for mass spectrometry due to its stable isotope labeling.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 129138-58-5
Clenbuterol-d9 hydrochloride
active pharmaceutical ingredient
1-[4-amino-3-chloro-5-(trifluoromethyl)phenyl]-2-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]ethanol
deuterated research standard
Hydroxymethyl Clenbuterol-d6
deuterium-labeled reference standard
2-Amino Nevirapine-d3
isotope-labeled research compound
4-Fluoroaniline-2,3,5,6-d4
isotope-labeled research compound
((2R)-2-Acetyloxy-4-hydroxy-4-oxobutyl)-dimethyl-(trideuteriomethyl)azanium chloride
isotope-labeled research compound
Phenanthrene D10
isotope-labeled research compound
N-alpha-(9-Fluorenylmethyloxycarbonyl)-L-prolinyl-L-proline
research compound for peptide synthesis
1-(4-amino-3,5-dichlorophenyl)-2-[[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]amino]ethanol
STJMRWALKKWQGH-GQALSZNTSA-N
[2H]C([2H])([2H])C(C([2H])([2H])[2H])(C([2H])([2H])[2H])NCC(C1=CC(=C(C(=C1)Cl)N)Cl)O