This compound is a metallocene consisting of a ruthenium atom bound between two cyclopentadiene rings. It is identified as a research reagent and is commonly used in laboratory settings for synthetic and coordination chemistry studies.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 1287-13-4
Dicyclopentadienyliron
antiknock gasoline additive
Methyl N-[6-(1,1,2,2,3,3,3-heptadeuteriopropylsulfanyl)-1H-benzimidazol-2-yl]carbamate
Deuterated labelled research compound
(-)-Butorphanol-d6
pharmaceutical reference standard
4-(Trifluoromethyl)phenylboronic acid
research compound for organic synthesis
5H-Cyclohepta[b]pyridine, 5-azido-6-(2,3-difluorophenyl)-6,7,8,9-tetrahydro-9-[[tris(1-methylethyl)silyl]oxy]-, (5S,6S,9R)-
research compound
Ethylferrocene
organoiron compound for chemical synthesis
BKEJVRMLCVMJLG-UHFFFAOYSA-N
C1=C[CH]C=C1.C1=C[CH]C=C1.[Ru]