2-Nitrofluorene-d9 is a deuterated research standard, specifically a nonadeuterio-labeled derivative of 7-nitrofluorene. Its primary significance lies in its use as an isotopically labeled reference compound for analytical and research applications.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 128008-87-7
2-Bromonicotinaldehyde
research compound
4-Bromo-2-fluoropyridine
research reagent
3-(Dimethylamino)propyl chloride hydrochloride
research intermediate for organic synthesis
2'-OMe PAC Abeta-cyanoethyl phosphoramidite
Oligonucleotide synthesis phosphoramidite building block
1,2,3,4,5,6,8,9,9-nonadeuterio-7-nitrofluorene
XFOHWECQTFIEIX-MFNUZUOVSA-N
[2H]C1=C(C(=C2C(=C1[2H])C3=C(C2([2H])[2H])C(=C(C(=C3[2H])[2H])[N+](=O)[O-])[2H])[2H])[2H]