Aminofluoro hydroxybenzoate is a research compound with a complex aromatic ester structure. It is characterized by the presence of amine, ether, and halogen functional groups, and is used primarily in laboratory research settings.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 1253799-29-9
4-(naphthalen-1-yl)aniline
research compound
((Z)-2-((3R,4R,5R)-3,5-Bis((tert-butyldimethylsilyl)oxy)-4-(3-((tert-butyldiphenylsilyl)oxy)propoxy)-2-methylenecyclohexylidene)ethyl)diphenylphosphine oxide
chemical research reagent
4-Fluoro(phenyl-d4)-boronic acid
research compound
2-(4-Fluorophenyl)-7,8-dimethoxyquinolin-4(1H)-one
research compound
phenyl 5-(dibenzylamino)-3-fluoro-2-methyl-6-phenylmethoxybenzoate
VRXGVVAMXZXKNA-UHFFFAOYSA-N
CC1=C(C=C(C(=C1C(=O)OC2=CC=CC=C2)OCC3=CC=CC=C3)N(CC4=CC=CC=C4)CC5=CC=CC=C5)F