This compound is a pharmaceutical intermediate used in the synthesis of other active pharmaceutical ingredients. It features a complex structure with aromatic rings and multiple functional groups.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 124832-31-1
Cbz-Valine ganciclovir
Nucleotide analog antiviral intermediate
O-Acetyl N-Benzyloxycarbonyl Valganciclovir
Pharmaceutical intermediate for antiviral synthesis
(R)-Azepan-3-amine
Pharmaceutical intermediate
2-(propylsulfanyl)pyrimidin-5-amine
Pharmaceutical intermediate
Dextrorphane
pharmaceutical intermediate
2-(1-(tert-butoxycarbonyl)-4-hydroxypiperidin-4-yl)-2-methylpropanoic acid
Pharmaceutical intermediate for drug synthesis
2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]ethyl (2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoate
ZQSUAJRZJTUOEA-HNNXBMFYSA-N
CC(C)[C@@H](C(=O)OCCOCN1C=NC2=C1N=C(NC2=O)N)NC(=O)OCC3=CC=CC=C3