4-Aminocyclohexanol-d10 is a deuterated research compound where all hydrogen atoms on the cyclohexane ring are replaced by deuterium, incorporating both an amino and a hydroxyl functional group. It is primarily used as an analytical standard or labeled reagent in chemical and biological research to study metabolic pathways or reaction mechanisms.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 1241045-80-6
MMP-inhibitor I
matrix metalloproteinase inhibitor
Enzalutamide metabolite M5
research compound
Methyl 5-bromo-3-hydroxypicolinate
research chemical intermediate
5-Trifluoromethyl-pyridine-2-carboxylic acid methyl ester
research compound
4-Aminocyclohexanol
research compound for testicular atrophy studies
(1s,4s)-4-aminocyclohexan-1-ol hydrochloride
intermediate for ambroxol impurity synthesis
(1s,4s)-4-aminocyclohexan-1-ol hydrochloride
pharmaceutical intermediate
4-amino-1,2,2,3,3,4,5,5,6,6-decadeuteriocyclohexan-1-ol
IMLXLGZJLAOKJN-MBXGXEIXSA-N
[2H]C1(C(C(C(C(C1([2H])N)([2H])[2H])([2H])[2H])([2H])O)([2H])[2H])[2H]