4-Aminocarbonylphenylboronic acid is a boronic acid derivative containing an amide functional group and an aromatic ring. It is primarily used as a research reagent in boron chemistry and related synthetic applications.
Geltungsbereich: Die Informationen auf dieser Seite betreffen die Identifizierung von Chemikalien sowie industrielle Liefer-, Forschungs- und Produktionskontexte. Sie stellen keine Heilversprechen, medizinische Beratung oder Anwendungshinweise für Arzneimittel dar.
Beschaffen oder liefern Sie diese Verbindung?
Inventar einstellen oder Kaufanfrage stellen
CAS 123088-59-5
(S)-3-([1,1'-biphenyl]-4-yl)-2-amino-2-methylpropanoic acid
research compound
(S)-2-Amino-2-methylpent-4-ynoic acid
Research compound
EthaniMidaMide, N-(4-broMo-2,6-difluorophenyl)-N'-(1-Methylethyl)-
research compound
(S)-GLYCIDOXY-T-BUTYLDIMETHYLSILANE
Research reagent for organic synthesis
(4-carbamoylphenyl)boronic acid
GNRHNKBJNUVWFZ-UHFFFAOYSA-N
B(C1=CC=C(C=C1)C(=O)N)(O)O